C16H21NO2 — CID 58441700
(E)-2,7,7-trimethyl-1-pyridin-2-yloct-1-ene-3,6-dione (PubChem CID 58441700) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-2,7,7-trimethyl-1-pyridin-2-yloct-1-ene-3,6-dione.
| Compound Name | (E)-2,7,7-trimethyl-1-pyridin-2-yloct-1-ene-3,6-dione |
|---|---|
| PubChem CID | 58441700 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (E)-2,7,7-trimethyl-1-pyridin-2-yloct-1-ene-3,6-dione |
| SMILES | C/C(=C\c1ccccn1)C(=O)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H21NO2/c1-12(11-13-7-5-6-10-17-13)14(18)8-9-15(19)16(2,3)4/h5-7,10-11H,8-9H2,1-4H3/b12-11+ |
| InChIKey | DVMZGSUIOJWJBX-VAWYXSNFSA-N |
| XLogP | 3.45 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|