C11H14O — CID 135043969
1-(2-deuteriophenyl)-2,2-dimethylpropan-1-one (PubChem CID 135043969) has the molecular formula C11H14O and a molecular weight of 163.24 g/mol. Its IUPAC name is 1-(2-deuteriophenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(2-deuteriophenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 135043969 |
| Molecular Formula | C11H14O |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1-(2-deuteriophenyl)-2,2-dimethylpropan-1-one |
| SMILES | [2H]c1ccccc1C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H14O/c1-11(2,3)10(12)9-7-5-4-6-8-9/h4-8H,1-3H3/i7D |
| InChIKey | OECPUBRNDKXFDX-WHRKIXHSSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |