C13H10O — CID 11446765
bis(2,6-dideuteriophenyl)methanone (PubChem CID 11446765) has the molecular formula C13H10O and a molecular weight of 186.25 g/mol. Its IUPAC name is bis(2,6-dideuteriophenyl)methanone.
| Compound Name | bis(2,6-dideuteriophenyl)methanone |
|---|---|
| PubChem CID | 11446765 |
| Molecular Formula | C13H10O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | bis(2,6-dideuteriophenyl)methanone |
| SMILES | [2H]c1cccc([2H])c1C(=O)c1c([2H])cccc1[2H] |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i7D,8D,9D,10D |
| InChIKey | RWCCWEUUXYIKHB-ULDPCNCHSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |