C15H22BNO5 — CID 154810172
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)borinic acid (PubChem CID 154810172) has the molecular formula C15H22BNO5 and a molecular weight of 307.16 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)borinic acid |
|---|---|
| PubChem CID | 154810172 |
| Molecular Formula | C15H22BNO5 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)borinic acid |
| SMILES | Cc1c(B(O)OC(C)(C)C(C)(C)O)ccc2c1NC(=O)CO2 |
| InChI | InChI=1S/C15H22BNO5/c1-9-10(16(20)22-15(4,5)14(2,3)19)6-7-11-13(9)17-12(18)8-21-11/h6-7,19-20H,8H2,1-5H3,(H,17,18) |
| InChIKey | QDMSDORDDKVTPG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|