C18H30BNO4 — CID 56844707
[4-(diethylcarbamoyl)-2-methylphenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 56844707) has the molecular formula C18H30BNO4 and a molecular weight of 335.25 g/mol. Its IUPAC name is [4-(diethylcarbamoyl)-2-methylphenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [4-(diethylcarbamoyl)-2-methylphenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 56844707 |
| Molecular Formula | C18H30BNO4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | [4-(diethylcarbamoyl)-2-methylphenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCN(CC)C(=O)c1ccc(B(O)OC(C)(C)C(C)(C)O)c(C)c1 |
| InChI | InChI=1S/C18H30BNO4/c1-8-20(9-2)16(21)14-10-11-15(13(3)12-14)19(23)24-18(6,7)17(4,5)22/h10-12,22-23H,8-9H2,1-7H3 |
| InChIKey | CMKQVXWRHTUAAT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|