C14H22N2O3 — CID 115168800
[2-(2,5-dimethoxy-4-methylphenyl)-2-methylpropyl]urea (PubChem CID 115168800) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is [2-(2,5-dimethoxy-4-methylphenyl)-2-methylpropyl]urea.
| Compound Name | [2-(2,5-dimethoxy-4-methylphenyl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 115168800 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [2-(2,5-dimethoxy-4-methylphenyl)-2-methylpropyl]urea |
| SMILES | COc1cc(C(C)(C)CNC(N)=O)c(OC)cc1C |
| InChI | InChI=1S/C14H22N2O3/c1-9-6-12(19-5)10(7-11(9)18-4)14(2,3)8-16-13(15)17/h6-7H,8H2,1-5H3,(H3,15,16,17) |
| InChIKey | SHPHLAVWHNAEFZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |