About (2,6-dimethylphenyl)methylphosphane;hydrobromide
(2,6-dimethylphenyl)methylphosphane;hydrobromide (PubChem CID 173123679) has the molecular formula C9H14BrP
and a molecular weight of 233.09 g/mol. Its IUPAC name is (2,6-dimethylphenyl)methylphosphane;hydrobromide.
Molecular Properties
| Compound Name | (2,6-dimethylphenyl)methylphosphane;hydrobromide |
| PubChem CID | 173123679 |
| Molecular Formula | C9H14BrP |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | (2,6-dimethylphenyl)methylphosphane;hydrobromide |
| SMILES | Br.Cc1cccc(C)c1CP |
| InChI | InChI=1S/C9H13P.BrH/c1-7-4-3-5-8(2)9(7)6-10;/h3-5H,6,10H2,1-2H3;1H |
| InChIKey | JSKGRQVKJDFFJM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethylphenyl)methylphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylphenyl)methylphosphane;hydrobromide?
The IUPAC name of (2,6-dimethylphenyl)methylphosphane;hydrobromide (CID 173123679) is (2,6-dimethylphenyl)methylphosphane;hydrobromide.
What is the SMILES notation for (2,6-dimethylphenyl)methylphosphane;hydrobromide?
The canonical SMILES for (2,6-dimethylphenyl)methylphosphane;hydrobromide is Br.Cc1cccc(C)c1CP.
What is the InChIKey of (2,6-dimethylphenyl)methylphosphane;hydrobromide?
The InChIKey is JSKGRQVKJDFFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13P.BrH/c1-7-4-3-5-8(2)9(7)6-10;/h3-5H,6,10H2,1-2H3;1H.
What are the key properties of (2,6-dimethylphenyl)methylphosphane;hydrobromide?
(2,6-dimethylphenyl)methylphosphane;hydrobromide has a molecular weight of 233.09 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylphenyl)methylphosphane;hydrobromide is sourced from PubChem (CID 173123679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).