C11H16F2Si — CID 123512111
3-(2,6-dimethylphenyl)propyl-difluorosilane (PubChem CID 123512111) has the molecular formula C11H16F2Si and a molecular weight of 214.33 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)propyl-difluorosilane.
| Compound Name | 3-(2,6-dimethylphenyl)propyl-difluorosilane |
|---|---|
| PubChem CID | 123512111 |
| Molecular Formula | C11H16F2Si |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-(2,6-dimethylphenyl)propyl-difluorosilane |
| SMILES | Cc1cccc(C)c1CCC[SiH](F)F |
| InChI | InChI=1S/C11H16F2Si/c1-9-5-3-6-10(2)11(9)7-4-8-14(12)13/h3,5-6,14H,4,7-8H2,1-2H3 |
| InChIKey | LIWUHUURVXASNW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|