C19H19F3 — CID 54186156
1,2-difluoro-4-[4-(7-fluorohept-6-enyl)phenyl]benzene (PubChem CID 54186156) has the molecular formula C19H19F3 and a molecular weight of 304.36 g/mol. Its IUPAC name is 1,2-difluoro-4-[4-(7-fluorohept-6-enyl)phenyl]benzene.
| Compound Name | 1,2-difluoro-4-[4-(7-fluorohept-6-enyl)phenyl]benzene |
|---|---|
| PubChem CID | 54186156 |
| Molecular Formula | C19H19F3 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1,2-difluoro-4-[4-(7-fluorohept-6-enyl)phenyl]benzene |
| SMILES | FC=CCCCCCc1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H19F3/c20-13-5-3-1-2-4-6-15-7-9-16(10-8-15)17-11-12-18(21)19(22)14-17/h5,7-14H,1-4,6H2 |
| InChIKey | PFGHKONSRQDTLY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|