C26H31F3 — CID 19798704
1,2-difluoro-4-[4-[4-[(E)-8-fluorooct-7-enyl]cyclohexyl]phenyl]benzene (PubChem CID 19798704) has the molecular formula C26H31F3 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1,2-difluoro-4-[4-[4-[(E)-8-fluorooct-7-enyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1,2-difluoro-4-[4-[4-[(E)-8-fluorooct-7-enyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 19798704 |
| Molecular Formula | C26H31F3 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1,2-difluoro-4-[4-[4-[(E)-8-fluorooct-7-enyl]cyclohexyl]phenyl]benzene |
| SMILES | F/C=C/CCCCCCC1CCC(c2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C26H31F3/c27-18-6-4-2-1-3-5-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-17-25(28)26(29)19-24/h6,12-21H,1-5,7-11H2/b18-6+ |
| InChIKey | XTSFRQQXMNICIH-NGYBGAFCSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|