C17H24F2N2O — CID 119610887
N-[2-(aminomethyl)cyclohexyl]-4-(3,4-difluorophenyl)butanamide (PubChem CID 119610887) has the molecular formula C17H24F2N2O and a molecular weight of 310.39 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-(3,4-difluorophenyl)butanamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-(3,4-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 119610887 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-(3,4-difluorophenyl)butanamide |
| SMILES | NCC1CCCCC1NC(=O)CCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H24F2N2O/c18-14-9-8-12(10-15(14)19)4-3-7-17(22)21-16-6-2-1-5-13(16)11-20/h8-10,13,16H,1-7,11,20H2,(H,21,22) |
| InChIKey | JTLZFFPZRMORBQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |