C15H19F2NO2 — CID 103860383
2-(3,4-difluorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]acetamide (PubChem CID 103860383) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]acetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 103860383 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1)NC1CCCCC1CO |
| InChI | InChI=1S/C15H19F2NO2/c16-12-6-5-10(7-13(12)17)8-15(20)18-14-4-2-1-3-11(14)9-19/h5-7,11,14,19H,1-4,8-9H2,(H,18,20) |
| InChIKey | UEBZALWPWJMNQW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |