C17H21F2NO3 — CID 120532973
2-[[2-(3,4-difluorophenyl)acetyl]amino]cyclooctane-1-carboxylic acid (PubChem CID 120532973) has the molecular formula C17H21F2NO3 and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-[[2-(3,4-difluorophenyl)acetyl]amino]cyclooctane-1-carboxylic acid.
| Compound Name | 2-[[2-(3,4-difluorophenyl)acetyl]amino]cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 120532973 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[[2-(3,4-difluorophenyl)acetyl]amino]cyclooctane-1-carboxylic acid |
| SMILES | O=C(Cc1ccc(F)c(F)c1)NC1CCCCCCC1C(=O)O |
| InChI | InChI=1S/C17H21F2NO3/c18-13-8-7-11(9-14(13)19)10-16(21)20-15-6-4-2-1-3-5-12(15)17(22)23/h7-9,12,15H,1-6,10H2,(H,20,21)(H,22,23) |
| InChIKey | KQLKZGCNBAFRHV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |