C17H23F3N2O2 — CID 119611618
N-[2-(aminomethyl)cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 119611618) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 119611618 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | NCC1CCCCC1NC(=O)CCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H23F3N2O2/c18-17(19,20)24-14-8-5-12(6-9-14)7-10-16(23)22-15-4-2-1-3-13(15)11-21/h5-6,8-9,13,15H,1-4,7,10-11,21H2,(H,22,23) |
| InChIKey | DGLOIVXPRGIGIB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |