C13H18F2N2 — CID 115210742
N-[(3,4-difluorophenyl)methyl]-2-pyrrolidin-3-ylethanamine (PubChem CID 115210742) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-2-pyrrolidin-3-ylethanamine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-2-pyrrolidin-3-ylethanamine |
|---|---|
| PubChem CID | 115210742 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-2-pyrrolidin-3-ylethanamine |
| SMILES | Fc1ccc(CNCCC2CCNC2)cc1F |
| InChI | InChI=1S/C13H18F2N2/c14-12-2-1-11(7-13(12)15)9-17-6-4-10-3-5-16-8-10/h1-2,7,10,16-17H,3-6,8-9H2 |
| InChIKey | AWRCYKZGMMGOMD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|