C14H20ClFN2 — CID 117044344
N-[(5-chloro-2-fluorophenyl)methyl]-2-piperidin-3-ylethanamine (PubChem CID 117044344) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-2-piperidin-3-ylethanamine.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-2-piperidin-3-ylethanamine |
|---|---|
| PubChem CID | 117044344 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-2-piperidin-3-ylethanamine |
| SMILES | Fc1ccc(Cl)cc1CNCCC1CCCNC1 |
| InChI | InChI=1S/C14H20ClFN2/c15-13-3-4-14(16)12(8-13)10-18-7-5-11-2-1-6-17-9-11/h3-4,8,11,17-18H,1-2,5-7,9-10H2 |
| InChIKey | FXASTKZCKNFEAI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|