C27H35F3O — CID 139813157
1-[4-[4-methyl-5-(trifluoromethoxy)heptyl]cyclohexyl]-2-phenylbenzene (PubChem CID 139813157) has the molecular formula C27H35F3O and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[4-[4-methyl-5-(trifluoromethoxy)heptyl]cyclohexyl]-2-phenylbenzene.
| Compound Name | 1-[4-[4-methyl-5-(trifluoromethoxy)heptyl]cyclohexyl]-2-phenylbenzene |
|---|---|
| PubChem CID | 139813157 |
| Molecular Formula | C27H35F3O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 1-[4-[4-methyl-5-(trifluoromethoxy)heptyl]cyclohexyl]-2-phenylbenzene |
| SMILES | CCC(OC(F)(F)F)C(C)CCCC1CCC(c2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H35F3O/c1-3-26(31-27(28,29)30)20(2)10-9-11-21-16-18-23(19-17-21)25-15-8-7-14-24(25)22-12-5-4-6-13-22/h4-8,12-15,20-21,23,26H,3,9-11,16-19H2,1-2H3 |
| InChIKey | SDFYIJFWMRYQOP-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |