C28H31F3O — CID 139883033
(1R,2R)-2-heptyl-1-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883033) has the molecular formula C28H31F3O and a molecular weight of 440.55 g/mol. Its IUPAC name is (1R,2R)-2-heptyl-1-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-2-heptyl-1-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883033 |
| Molecular Formula | C28H31F3O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (1R,2R)-2-heptyl-1-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCCCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C28H31F3O/c1-2-3-4-5-6-10-21-15-18-25-24-11-8-7-9-20(24)14-19-26(25)27(21)22-12-16-23(17-13-22)32-28(29,30)31/h7-9,11-14,16-17,19,21,27H,2-6,10,15,18H2,1H3/t21-,27-/m1/s1 |
| InChIKey | XXGZECYNLRFESQ-JIPXPUAJSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|