C26H29F — CID 139883115
(1R,2R)-1-(4-fluorophenyl)-2-hexyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883115) has the molecular formula C26H29F and a molecular weight of 360.52 g/mol. Its IUPAC name is (1R,2R)-1-(4-fluorophenyl)-2-hexyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-1-(4-fluorophenyl)-2-hexyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883115 |
| Molecular Formula | C26H29F |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1R,2R)-1-(4-fluorophenyl)-2-hexyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H29F/c1-2-3-4-5-9-20-14-17-24-23-10-7-6-8-19(23)13-18-25(24)26(20)21-11-15-22(27)16-12-21/h6-8,10-13,15-16,18,20,26H,2-5,9,14,17H2,1H3/t20-,26-/m1/s1 |
| InChIKey | JOJCCDRCEDFEMU-FQRUVTKNSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|