C26H27ClF2 — CID 139883154
(1R,2R)-1-(4-chloro-3-fluorophenyl)-8-fluoro-2-hexyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883154) has the molecular formula C26H27ClF2 and a molecular weight of 412.95 g/mol. Its IUPAC name is (1R,2R)-1-(4-chloro-3-fluorophenyl)-8-fluoro-2-hexyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-1-(4-chloro-3-fluorophenyl)-8-fluoro-2-hexyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883154 |
| Molecular Formula | C26H27ClF2 |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (1R,2R)-1-(4-chloro-3-fluorophenyl)-8-fluoro-2-hexyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCCCC[C@@H]1CCc2c(ccc3c(F)cccc23)[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C26H27ClF2/c1-2-3-4-5-7-17-10-12-20-19-8-6-9-24(28)21(19)13-14-22(20)26(17)18-11-15-23(27)25(29)16-18/h6,8-9,11,13-17,26H,2-5,7,10,12H2,1H3/t17-,26-/m1/s1 |
| InChIKey | SJRYZIARBHUKEU-WGDIFIGCSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|