C28H30F4 — CID 139883178
(1R,2R)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-heptyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883178) has the molecular formula C28H30F4 and a molecular weight of 442.54 g/mol. Its IUPAC name is (1R,2R)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-heptyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-heptyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883178 |
| Molecular Formula | C28H30F4 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (1R,2R)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-heptyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCCCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C28H30F4/c1-2-3-4-5-6-10-20-13-15-23-22-11-8-7-9-19(22)12-16-24(23)27(20)21-14-17-25(26(29)18-21)28(30,31)32/h7-9,11-12,14,16-18,20,27H,2-6,10,13,15H2,1H3/t20-,27-/m1/s1 |
| InChIKey | XBKBKBVQNHYSTB-NFQMXDRXSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|