C27H24F4 — CID 139883179
(1R,2R)-2-butyl-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883179) has the molecular formula C27H24F4 and a molecular weight of 424.48 g/mol. Its IUPAC name is (1R,2R)-2-butyl-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-2-butyl-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883179 |
| Molecular Formula | C27H24F4 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (1R,2R)-2-butyl-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1C#Cc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C27H24F4/c1-2-3-6-19-11-14-23-21-8-5-4-7-20(21)12-15-24(23)22(19)13-9-18-10-16-25(26(28)17-18)27(29,30)31/h4-5,7-8,10,12,15-17,19,22H,2-3,6,11,14H2,1H3/t19-,22+/m1/s1 |
| InChIKey | XDEGWERBFPQMSW-KNQAVFIVSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|