C27H25F3O — CID 139883066
(1R,2R)-2-butyl-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883066) has the molecular formula C27H25F3O and a molecular weight of 422.49 g/mol. Its IUPAC name is (1R,2R)-2-butyl-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-2-butyl-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883066 |
| Molecular Formula | C27H25F3O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (1R,2R)-2-butyl-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1C#Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H25F3O/c1-2-3-6-20-12-17-25-23-8-5-4-7-21(23)13-18-26(25)24(20)16-11-19-9-14-22(15-10-19)31-27(28,29)30/h4-5,7-10,13-15,18,20,24H,2-3,6,12,17H2,1H3/t20-,24+/m1/s1 |
| InChIKey | RNCVZNDSYDRLPL-YKSBVNFPSA-N |
| XLogP | 7.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|