C24H20F2 — CID 139883241
(1R,2R)-1-[2-(3,4-difluorophenyl)ethynyl]-2-ethyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883241) has the molecular formula C24H20F2 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1R,2R)-1-[2-(3,4-difluorophenyl)ethynyl]-2-ethyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-1-[2-(3,4-difluorophenyl)ethynyl]-2-ethyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883241 |
| Molecular Formula | C24H20F2 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (1R,2R)-1-[2-(3,4-difluorophenyl)ethynyl]-2-ethyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1C#Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H20F2/c1-2-17-9-12-21-19-6-4-3-5-18(19)10-13-22(21)20(17)11-7-16-8-14-23(25)24(26)15-16/h3-6,8,10,13-15,17,20H,2,9,12H2,1H3/t17-,20+/m1/s1 |
| InChIKey | QKYREFSGYVEXKL-XLIONFOSSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|