C25H23F5 — CID 139883153
(1R,2R)-2-butyl-1-[3,5-difluoro-4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883153) has the molecular formula C25H23F5 and a molecular weight of 418.45 g/mol. Its IUPAC name is (1R,2R)-2-butyl-1-[3,5-difluoro-4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-2-butyl-1-[3,5-difluoro-4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883153 |
| Molecular Formula | C25H23F5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (1R,2R)-2-butyl-1-[3,5-difluoro-4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1c1cc(F)c(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C25H23F5/c1-2-3-6-16-10-11-19-18-8-5-4-7-15(18)9-12-20(19)23(16)17-13-21(26)24(22(27)14-17)25(28,29)30/h4-5,7-9,12-14,16,23H,2-3,6,10-11H2,1H3/t16-,23-/m1/s1 |
| InChIKey | MOCHTHIFVQBJGO-WAIKUNEKSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |