C30H31F3 — CID 139883189
(1R,2R)-2-heptyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883189) has the molecular formula C30H31F3 and a molecular weight of 448.57 g/mol. Its IUPAC name is (1R,2R)-2-heptyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-2-heptyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883189 |
| Molecular Formula | C30H31F3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (1R,2R)-2-heptyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCCCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H31F3/c1-2-3-4-5-6-9-24-16-20-28-26-11-8-7-10-23(26)15-21-29(28)27(24)19-14-22-12-17-25(18-13-22)30(31,32)33/h7-8,10-13,15,17-18,21,24,27H,2-6,9,16,20H2,1H3/t24-,27+/m1/s1 |
| InChIKey | WPYIBUZCEZUWEF-SQHAQQRYSA-N |
| XLogP | 8.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|