C28H27F3 — CID 139883007
(1R,2R)-2-pentyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 139883007) has the molecular formula C28H27F3 and a molecular weight of 420.52 g/mol. Its IUPAC name is (1R,2R)-2-pentyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (1R,2R)-2-pentyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 139883007 |
| Molecular Formula | C28H27F3 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (1R,2R)-2-pentyl-1-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CCCCC[C@@H]1CCc2c(ccc3ccccc23)[C@H]1C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H27F3/c1-2-3-4-7-22-14-18-26-24-9-6-5-8-21(24)13-19-27(26)25(22)17-12-20-10-15-23(16-11-20)28(29,30)31/h5-6,8-11,13,15-16,19,22,25H,2-4,7,14,18H2,1H3/t22-,25+/m1/s1 |
| InChIKey | LGWBKGFSAJCQIV-RDGATRHJSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|