C26H21ClF3NO — CID 144798629
N-[(3-chlorophenyl)methyl]-1-[4-[4-(trifluoromethoxy)phenyl]naphthalen-2-yl]ethanamine (PubChem CID 144798629) has the molecular formula C26H21ClF3NO and a molecular weight of 455.91 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-[4-[4-(trifluoromethoxy)phenyl]naphthalen-2-yl]ethanamine.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-[4-[4-(trifluoromethoxy)phenyl]naphthalen-2-yl]ethanamine |
|---|---|
| PubChem CID | 144798629 |
| Molecular Formula | C26H21ClF3NO |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-[4-[4-(trifluoromethoxy)phenyl]naphthalen-2-yl]ethanamine |
| SMILES | CC(NCc1cccc(Cl)c1)c1cc(-c2ccc(OC(F)(F)F)cc2)c2ccccc2c1 |
| InChI | InChI=1S/C26H21ClF3NO/c1-17(31-16-18-5-4-7-22(27)13-18)21-14-20-6-2-3-8-24(20)25(15-21)19-9-11-23(12-10-19)32-26(28,29)30/h2-15,17,31H,16H2,1H3 |
| InChIKey | MLFFOXZJDBDTSX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |