C26H25F3N2O — CID 58803196
(1R)-N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-phenylethanamine (PubChem CID 58803196) has the molecular formula C26H25F3N2O and a molecular weight of 438.49 g/mol. Its IUPAC name is (1R)-N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 58803196 |
| Molecular Formula | C26H25F3N2O |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (1R)-N-[[1-ethyl-3-[4-(trifluoromethoxy)phenyl]indol-5-yl]methyl]-1-phenylethanamine |
| SMILES | CCn1cc(-c2ccc(OC(F)(F)F)cc2)c2cc(CN[C@H](C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C26H25F3N2O/c1-3-31-17-24(21-10-12-22(13-11-21)32-26(27,28)29)23-15-19(9-14-25(23)31)16-30-18(2)20-7-5-4-6-8-20/h4-15,17-18,30H,3,16H2,1-2H3/t18-/m1/s1 |
| InChIKey | YZHJJJQHBYBNFQ-GOSISDBHSA-N |
| XLogP | 7.08 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |