C51H51N3 — CID 102413892
10,18-bis(4-tert-butylphenyl)-N-[(1R)-1-phenylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine (PubChem CID 102413892) has the molecular formula C51H51N3 and a molecular weight of 705.99 g/mol. Its IUPAC name is 10,18-bis(4-tert-butylphenyl)-N-[(1R)-1-phenylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine.
| Compound Name | 10,18-bis(4-tert-butylphenyl)-N-[(1R)-1-phenylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine |
|---|---|
| PubChem CID | 102413892 |
| Molecular Formula | C51H51N3 |
| Molecular Weight | 705.99 g/mol |
| Exact Mass | 705.41 |
| IUPAC Name | 10,18-bis(4-tert-butylphenyl)-N-[(1R)-1-phenylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine |
| SMILES | C[C@@H](N/C1=N/Cc2c(-c3ccc(C(C)(C)C)cc3)cc3ccccc3c2-c2c(c(-c3ccc(C(C)(C)C)cc3)cc3ccccc23)CN1)c1ccccc1 |
| InChI | InChI=1S/C51H51N3/c1-33(34-15-9-8-10-16-34)54-49-52-31-45-43(35-21-25-39(26-22-35)50(2,3)4)29-37-17-11-13-19-41(37)47(45)48-42-20-14-12-18-38(42)30-44(46(48)32-53-49)36-23-27-40(28-24-36)51(5,6)7/h8-30,33H,31-32H2,1-7H3,(H2,52,53,54)/t33-/m1/s1 |
| InChIKey | OHDQEPVMHFPGJW-MGBGTMOVSA-N |
| XLogP | 12.90 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.99 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |