C50H35F6N3 — CID 11343306
N-benzhydryl-10,18-bis[4-(trifluoromethyl)phenyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine (PubChem CID 11343306) has the molecular formula C50H35F6N3 and a molecular weight of 791.84 g/mol. Its IUPAC name is N-benzhydryl-10,18-bis[4-(trifluoromethyl)phenyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine.
| Compound Name | N-benzhydryl-10,18-bis[4-(trifluoromethyl)phenyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine |
|---|---|
| PubChem CID | 11343306 |
| Molecular Formula | C50H35F6N3 |
| Molecular Weight | 791.84 g/mol |
| Exact Mass | 791.27 |
| IUPAC Name | N-benzhydryl-10,18-bis[4-(trifluoromethyl)phenyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine |
| SMILES | FC(F)(F)c1ccc(-c2cc3ccccc3c3c2C/N=C(/NC(c2ccccc2)c2ccccc2)NCc2c(-c4ccc(C(F)(F)F)cc4)cc4ccccc4c2-3)cc1 |
| InChI | InChI=1S/C50H35F6N3/c51-49(52,53)37-23-19-31(20-24-37)41-27-35-15-7-9-17-39(35)45-43(41)29-57-48(59-47(33-11-3-1-4-12-33)34-13-5-2-6-14-34)58-30-44-42(28-36-16-8-10-18-40(36)46(44)45)32-21-25-38(26-22-32)50(54,55)56/h1-28,47H,29-30H2,(H2,57,58,59) |
| InChIKey | RAZLBRYAXIYCJB-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.84 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |