C55H53N3 — CID 102413895
10,18-bis(4-tert-butylphenyl)-N-[(1S)-1-naphthalen-1-ylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine (PubChem CID 102413895) has the molecular formula C55H53N3 and a molecular weight of 756.05 g/mol. Its IUPAC name is 10,18-bis(4-tert-butylphenyl)-N-[(1S)-1-naphthalen-1-ylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine.
| Compound Name | 10,18-bis(4-tert-butylphenyl)-N-[(1S)-1-naphthalen-1-ylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine |
|---|---|
| PubChem CID | 102413895 |
| Molecular Formula | C55H53N3 |
| Molecular Weight | 756.05 g/mol |
| Exact Mass | 755.42 |
| IUPAC Name | 10,18-bis(4-tert-butylphenyl)-N-[(1S)-1-naphthalen-1-ylethyl]-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,13,18,20,22,24-undecaen-14-amine |
| SMILES | C[C@H](N/C1=N/Cc2c(-c3ccc(C(C)(C)C)cc3)cc3ccccc3c2-c2c(c(-c3ccc(C(C)(C)C)cc3)cc3ccccc23)CN1)c1cccc2ccccc12 |
| InChI | InChI=1S/C55H53N3/c1-35(43-22-14-18-36-15-8-11-19-44(36)43)58-53-56-33-49-47(37-23-27-41(28-24-37)54(2,3)4)31-39-16-9-12-20-45(39)51(49)52-46-21-13-10-17-40(46)32-48(50(52)34-57-53)38-25-29-42(30-26-38)55(5,6)7/h8-32,35H,33-34H2,1-7H3,(H2,56,57,58)/t35-/m0/s1 |
| InChIKey | UMHYMBKVLOKOSC-DHUJRADRSA-N |
| XLogP | 14.05 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.05 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |