C64H69N3 — CID 136668980
10,18-bis[4-(3,5-ditert-butylphenyl)phenyl]-N-methyl-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,18,20,22,24-decaen-14-imine (PubChem CID 136668980) has the molecular formula C64H69N3 and a molecular weight of 880.28 g/mol. Its IUPAC name is 10,18-bis[4-(3,5-ditert-butylphenyl)phenyl]-N-methyl-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,18,20,22,24-decaen-14-imine.
| Compound Name | 10,18-bis[4-(3,5-ditert-butylphenyl)phenyl]-N-methyl-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,18,20,22,24-decaen-14-imine |
|---|---|
| PubChem CID | 136668980 |
| Molecular Formula | C64H69N3 |
| Molecular Weight | 880.28 g/mol |
| Exact Mass | 879.55 |
| IUPAC Name | 10,18-bis[4-(3,5-ditert-butylphenyl)phenyl]-N-methyl-13,15-diazapentacyclo[15.8.0.02,11.03,8.020,25]pentacosa-1(17),2(11),3,5,7,9,18,20,22,24-decaen-14-imine |
| SMILES | CN=C1NCc2c(-c3ccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc3)cc3ccccc3c2-c2c(c(-c3ccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc3)cc3ccccc23)CN1 |
| InChI | InChI=1S/C64H69N3/c1-61(2,3)48-30-46(31-49(36-48)62(4,5)6)40-22-26-42(27-23-40)54-34-44-18-14-16-20-52(44)58-56(54)38-66-60(65-13)67-39-57-55(35-45-19-15-17-21-53(45)59(57)58)43-28-24-41(25-29-43)47-32-50(63(7,8)9)37-51(33-47)64(10,11)12/h14-37H,38-39H2,1-13H3,(H2,65,66,67) |
| InChIKey | WKRGLPSRTWYDLS-UHFFFAOYSA-N |
| XLogP | 16.70 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.28 |
| LogP ≤ 5 | 16.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|