C60H64O2 — CID 177454331
1,4-bis[3-(3,5-ditert-butylphenyl)naphthalen-2-yl]-2,3-dimethoxynaphthalene (PubChem CID 177454331) has the molecular formula C60H64O2 and a molecular weight of 817.17 g/mol. Its IUPAC name is 1,4-bis[3-(3,5-ditert-butylphenyl)naphthalen-2-yl]-2,3-dimethoxynaphthalene.
| Compound Name | 1,4-bis[3-(3,5-ditert-butylphenyl)naphthalen-2-yl]-2,3-dimethoxynaphthalene |
|---|---|
| PubChem CID | 177454331 |
| Molecular Formula | C60H64O2 |
| Molecular Weight | 817.17 g/mol |
| Exact Mass | 816.49 |
| IUPAC Name | 1,4-bis[3-(3,5-ditert-butylphenyl)naphthalen-2-yl]-2,3-dimethoxynaphthalene |
| SMILES | COc1c(OC)c(-c2cc3ccccc3cc2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccccc2c1-c1cc2ccccc2cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H64O2/c1-57(2,3)43-27-41(28-44(35-43)58(4,5)6)49-31-37-21-15-17-23-39(37)33-51(49)53-47-25-19-20-26-48(47)54(56(62-14)55(53)61-13)52-34-40-24-18-16-22-38(40)32-50(52)42-29-45(59(7,8)9)36-46(30-42)60(10,11)12/h15-36H,1-14H3 |
| InChIKey | PKRLTIXVYJMUSO-UHFFFAOYSA-N |
| XLogP | 17.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.17 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |