C27H33OP — CID 175124243
[6-(3,5-ditert-butylphenyl)-2-methoxy-3-phenylphenyl]phosphane (PubChem CID 175124243) has the molecular formula C27H33OP and a molecular weight of 404.53 g/mol. Its IUPAC name is [6-(3,5-ditert-butylphenyl)-2-methoxy-3-phenylphenyl]phosphane.
| Compound Name | [6-(3,5-ditert-butylphenyl)-2-methoxy-3-phenylphenyl]phosphane |
|---|---|
| PubChem CID | 175124243 |
| Molecular Formula | C27H33OP |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | [6-(3,5-ditert-butylphenyl)-2-methoxy-3-phenylphenyl]phosphane |
| SMILES | COc1c(-c2ccccc2)ccc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1P |
| InChI | InChI=1S/C27H33OP/c1-26(2,3)20-15-19(16-21(17-20)27(4,5)6)23-14-13-22(24(28-7)25(23)29)18-11-9-8-10-12-18/h8-17H,29H2,1-7H3 |
| InChIKey | WNEOMUXNSACUKQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|