C56H50Si2 — CID 59391126
[4-[3,8-bis(4-methylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane (PubChem CID 59391126) has the molecular formula C56H50Si2 and a molecular weight of 779.19 g/mol. Its IUPAC name is [4-[3,8-bis(4-methylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane.
| Compound Name | [4-[3,8-bis(4-methylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 59391126 |
| Molecular Formula | C56H50Si2 |
| Molecular Weight | 779.19 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | [4-[3,8-bis(4-methylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane |
| SMILES | Cc1ccc(-c2cc(-c3ccc([Si](C)(C)C)c4ccccc34)c3ccc4c(-c5ccc(C)cc5)cc(-c5ccc([Si](C)(C)C)c6ccccc56)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C56H50Si2/c1-35-17-21-37(22-18-35)49-33-51(41-29-31-53(57(3,4)5)43-15-11-9-13-39(41)43)47-28-26-46-50(38-23-19-36(2)20-24-38)34-52(48-27-25-45(49)55(47)56(46)48)42-30-32-54(58(6,7)8)44-16-12-10-14-40(42)44/h9-34H,1-8H3 |
| InChIKey | WALNJNYAOFOYQZ-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.19 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|