C74H58Si2 — CID 59391271
[4-[3,8-bis(4-naphthalen-2-ylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane (PubChem CID 59391271) has the molecular formula C74H58Si2 and a molecular weight of 1003.45 g/mol. Its IUPAC name is [4-[3,8-bis(4-naphthalen-2-ylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane.
| Compound Name | [4-[3,8-bis(4-naphthalen-2-ylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 59391271 |
| Molecular Formula | C74H58Si2 |
| Molecular Weight | 1003.45 g/mol |
| Exact Mass | 1002.41 |
| IUPAC Name | [4-[3,8-bis(4-naphthalen-2-ylphenyl)-6-(4-trimethylsilylnaphthalen-1-yl)pyren-1-yl]naphthalen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(-c3ccc(-c4ccc5ccccc5c4)cc3)c3ccc4c(-c5ccc([Si](C)(C)C)c6ccccc56)cc(-c5ccc(-c6ccc7ccccc7c6)cc5)c5ccc2c3c54)c2ccccc12 |
| InChI | InChI=1S/C74H58Si2/c1-75(2,3)71-41-39-59(57-19-11-13-21-61(57)71)69-45-67(51-29-23-49(24-30-51)55-33-27-47-15-7-9-17-53(47)43-55)63-36-38-66-70(60-40-42-72(76(4,5)6)62-22-14-12-20-58(60)62)46-68(64-35-37-65(69)73(63)74(64)66)52-31-25-50(26-32-52)56-34-28-48-16-8-10-18-54(48)44-56/h7-46H,1-6H3 |
| InChIKey | MPWNGVRHGNMQCQ-UHFFFAOYSA-N |
| XLogP | 20.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.45 |
| LogP ≤ 5 | 20.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|