C39H36ClNO2Si — CID 140818666
4-[5-(4-chloro-2-methoxyphenyl)-8-methoxynaphthalen-1-yl]-N-phenyl-N-(4-trimethylsilylphenyl)aniline (PubChem CID 140818666) has the molecular formula C39H36ClNO2Si and a molecular weight of 614.26 g/mol. Its IUPAC name is 4-[5-(4-chloro-2-methoxyphenyl)-8-methoxynaphthalen-1-yl]-N-phenyl-N-(4-trimethylsilylphenyl)aniline.
| Compound Name | 4-[5-(4-chloro-2-methoxyphenyl)-8-methoxynaphthalen-1-yl]-N-phenyl-N-(4-trimethylsilylphenyl)aniline |
|---|---|
| PubChem CID | 140818666 |
| Molecular Formula | C39H36ClNO2Si |
| Molecular Weight | 614.26 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 4-[5-(4-chloro-2-methoxyphenyl)-8-methoxynaphthalen-1-yl]-N-phenyl-N-(4-trimethylsilylphenyl)aniline |
| SMILES | COc1cc(Cl)ccc1-c1ccc(OC)c2c(-c3ccc(N(c4ccccc4)c4ccc([Si](C)(C)C)cc4)cc3)cccc12 |
| InChI | InChI=1S/C39H36ClNO2Si/c1-42-37-25-24-34(35-23-16-28(40)26-38(35)43-2)36-13-9-12-33(39(36)37)27-14-17-30(18-15-27)41(29-10-7-6-8-11-29)31-19-21-32(22-20-31)44(3,4)5/h6-26H,1-5H3 |
| InChIKey | ARPWDDSNKMSERG-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.26 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|