C46H38N2Si — CID 59390751
N-phenyl-N-[4-[10-(2-phenylphenyl)anthracen-9-yl]phenyl]-5-trimethylsilylpyridin-2-amine (PubChem CID 59390751) has the molecular formula C46H38N2Si and a molecular weight of 646.91 g/mol. Its IUPAC name is N-phenyl-N-[4-[10-(2-phenylphenyl)anthracen-9-yl]phenyl]-5-trimethylsilylpyridin-2-amine.
| Compound Name | N-phenyl-N-[4-[10-(2-phenylphenyl)anthracen-9-yl]phenyl]-5-trimethylsilylpyridin-2-amine |
|---|---|
| PubChem CID | 59390751 |
| Molecular Formula | C46H38N2Si |
| Molecular Weight | 646.91 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | N-phenyl-N-[4-[10-(2-phenylphenyl)anthracen-9-yl]phenyl]-5-trimethylsilylpyridin-2-amine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccccc2)c2ccc(-c3c4ccccc4c(-c4ccccc4-c4ccccc4)c4ccccc34)cc2)nc1 |
| InChI | InChI=1S/C46H38N2Si/c1-49(2,3)37-30-31-44(47-32-37)48(35-18-8-5-9-19-35)36-28-26-34(27-29-36)45-40-22-12-14-24-42(40)46(43-25-15-13-23-41(43)45)39-21-11-10-20-38(39)33-16-6-4-7-17-33/h4-32H,1-3H3 |
| InChIKey | DGJKUHNYLMPPMD-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.91 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|