C15H12F2S — CID 54419898
1,3-difluoro-5-[2-(4-methylsulfanylphenyl)ethenyl]benzene (PubChem CID 54419898) has the molecular formula C15H12F2S and a molecular weight of 262.32 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-(4-methylsulfanylphenyl)ethenyl]benzene.
| Compound Name | 1,3-difluoro-5-[2-(4-methylsulfanylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 54419898 |
| Molecular Formula | C15H12F2S |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1,3-difluoro-5-[2-(4-methylsulfanylphenyl)ethenyl]benzene |
| SMILES | CSc1ccc(C=Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C15H12F2S/c1-18-15-6-4-11(5-7-15)2-3-12-8-13(16)10-14(17)9-12/h2-10H,1H3 |
| InChIKey | WABHZDIPKMSQMN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|