C15H16F2N2O2 — CID 153368047
4-[(2-amino-5-hydroxyphenyl)methylideneamino]-3,5-difluorophenol;ethane (PubChem CID 153368047) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 4-[(2-amino-5-hydroxyphenyl)methylideneamino]-3,5-difluorophenol;ethane.
| Compound Name | 4-[(2-amino-5-hydroxyphenyl)methylideneamino]-3,5-difluorophenol;ethane |
|---|---|
| PubChem CID | 153368047 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[(2-amino-5-hydroxyphenyl)methylideneamino]-3,5-difluorophenol;ethane |
| SMILES | CC.Nc1ccc(O)cc1/C=N/c1c(F)cc(O)cc1F |
| InChI | InChI=1S/C13H10F2N2O2.C2H6/c14-10-4-9(19)5-11(15)13(10)17-6-7-3-8(18)1-2-12(7)16;1-2/h1-6,18-19H,16H2;1-2H3/b17-6+; |
| InChIKey | VJHRCKUSYQYZAS-ZDEOBDHWSA-N |
| XLogP | 3.73 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|