About 4-amino-3-ethenylphenol
4-amino-3-ethenylphenol (PubChem CID 123878625) has the molecular formula C8H8NO-
and a molecular weight of 134.16 g/mol. Its IUPAC name is 4-amino-3-ethenylphenol.
Molecular Properties
| Compound Name | 4-amino-3-ethenylphenol |
| PubChem CID | 123878625 |
| Molecular Formula | C8H8NO- |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 4-amino-3-ethenylphenol |
| SMILES | [H]/[C-]=C/c1cc(O)ccc1N |
| InChI | InChI=1S/C8H8NO/c1-2-6-5-7(10)3-4-8(6)9/h1-5,10H,9H2/q-1 |
| InChIKey | SCZGNLPVRPWOMT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethenylphenol?
The IUPAC name of 4-amino-3-ethenylphenol (CID 123878625) is 4-amino-3-ethenylphenol.
What is the SMILES notation for 4-amino-3-ethenylphenol?
The canonical SMILES for 4-amino-3-ethenylphenol is [H]/[C-]=C/c1cc(O)ccc1N.
What is the InChIKey of 4-amino-3-ethenylphenol?
The InChIKey is SCZGNLPVRPWOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8NO/c1-2-6-5-7(10)3-4-8(6)9/h1-5,10H,9H2/q-1.
What are the key properties of 4-amino-3-ethenylphenol?
4-amino-3-ethenylphenol has a molecular weight of 134.16 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethenylphenol is sourced from PubChem (CID 123878625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).