C12H6Br2N4O6 — CID 21440771
N-(3,4-dibromophenyl)-2,4,6-trinitroaniline (PubChem CID 21440771) has the molecular formula C12H6Br2N4O6 and a molecular weight of 462.01 g/mol. Its IUPAC name is N-(3,4-dibromophenyl)-2,4,6-trinitroaniline.
| Compound Name | N-(3,4-dibromophenyl)-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 21440771 |
| Molecular Formula | C12H6Br2N4O6 |
| Molecular Weight | 462.01 g/mol |
| Exact Mass | 459.87 |
| IUPAC Name | N-(3,4-dibromophenyl)-2,4,6-trinitroaniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccc(Br)c(Br)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6Br2N4O6/c13-8-2-1-6(3-9(8)14)15-12-10(17(21)22)4-7(16(19)20)5-11(12)18(23)24/h1-5,15H |
| InChIKey | PVWBPYYLFUQYCB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.01 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|