C16H9N4O6- — CID 7233041
3-[(5,7-dinitroquinolin-8-yl)amino]benzoate (PubChem CID 7233041) has the molecular formula C16H9N4O6- and a molecular weight of 353.27 g/mol. Its IUPAC name is 3-[(5,7-dinitroquinolin-8-yl)amino]benzoate.
| Compound Name | 3-[(5,7-dinitroquinolin-8-yl)amino]benzoate |
|---|---|
| PubChem CID | 7233041 |
| Molecular Formula | C16H9N4O6- |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 3-[(5,7-dinitroquinolin-8-yl)amino]benzoate |
| SMILES | O=C([O-])c1cccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])c3cccnc23)c1 |
| InChI | InChI=1S/C16H10N4O6/c21-16(22)9-3-1-4-10(7-9)18-15-13(20(25)26)8-12(19(23)24)11-5-2-6-17-14(11)15/h1-8,18H,(H,21,22)/p-1 |
| InChIKey | YLZGNCPGJRPFQG-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 151.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|