C17H12N4O5 — CID 5213337
N-(5,7-dinitroquinolin-8-yl)-4-methylbenzamide (PubChem CID 5213337) has the molecular formula C17H12N4O5 and a molecular weight of 352.31 g/mol. Its IUPAC name is N-(5,7-dinitroquinolin-8-yl)-4-methylbenzamide.
| Compound Name | N-(5,7-dinitroquinolin-8-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 5213337 |
| Molecular Formula | C17H12N4O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-(5,7-dinitroquinolin-8-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2c([N+](=O)[O-])cc([N+](=O)[O-])c3cccnc23)cc1 |
| InChI | InChI=1S/C17H12N4O5/c1-10-4-6-11(7-5-10)17(22)19-16-14(21(25)26)9-13(20(23)24)12-3-2-8-18-15(12)16/h2-9H,1H3,(H,19,22) |
| InChIKey | CFBDDCJECIJDLI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|