C16H9Cl2N5O5 — CID 5213330
1-(3,4-dichlorophenyl)-3-(5,7-dinitroquinolin-8-yl)urea (PubChem CID 5213330) has the molecular formula C16H9Cl2N5O5 and a molecular weight of 422.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(5,7-dinitroquinolin-8-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(5,7-dinitroquinolin-8-yl)urea |
|---|---|
| PubChem CID | 5213330 |
| Molecular Formula | C16H9Cl2N5O5 |
| Molecular Weight | 422.18 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(5,7-dinitroquinolin-8-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C16H9Cl2N5O5/c17-10-4-3-8(6-11(10)18)20-16(24)21-15-13(23(27)28)7-12(22(25)26)9-2-1-5-19-14(9)15/h1-7H,(H2,20,21,24) |
| InChIKey | DVKIBWDADGAQGU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.18 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|