C17H14ClN5O3 — CID 108885513
1-(4-chloro-3-nitrophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea (PubChem CID 108885513) has the molecular formula C17H14ClN5O3 and a molecular weight of 371.78 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea |
|---|---|
| PubChem CID | 108885513 |
| Molecular Formula | C17H14ClN5O3 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea |
| SMILES | Cc1nc2ccc(NC(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)cc2nc1C |
| InChI | InChI=1S/C17H14ClN5O3/c1-9-10(2)20-15-7-11(4-6-14(15)19-9)21-17(24)22-12-3-5-13(18)16(8-12)23(25)26/h3-8H,1-2H3,(H2,21,22,24) |
| InChIKey | VBIFYESNQBGJSD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|