C17H16ClN5O — CID 108885532
1-(4-amino-2-chlorophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea (PubChem CID 108885532) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 1-(4-amino-2-chlorophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea.
| Compound Name | 1-(4-amino-2-chlorophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea |
|---|---|
| PubChem CID | 108885532 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(4-amino-2-chlorophenyl)-3-(2,3-dimethylquinoxalin-6-yl)urea |
| SMILES | Cc1nc2ccc(NC(=O)Nc3ccc(N)cc3Cl)cc2nc1C |
| InChI | InChI=1S/C17H16ClN5O/c1-9-10(2)21-16-8-12(4-6-15(16)20-9)22-17(24)23-14-5-3-11(19)7-13(14)18/h3-8H,19H2,1-2H3,(H2,22,23,24) |
| InChIKey | QCRHRFBRKXRAKS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|