C18H17N5O3 — CID 133301195
N-(5-methyl-2-pyridinyl)-3-[(5-nitroquinolin-8-yl)amino]propanamide (PubChem CID 133301195) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-3-[(5-nitroquinolin-8-yl)amino]propanamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-3-[(5-nitroquinolin-8-yl)amino]propanamide |
|---|---|
| PubChem CID | 133301195 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-3-[(5-nitroquinolin-8-yl)amino]propanamide |
| SMILES | Cc1ccc(NC(=O)CCNc2ccc([N+](=O)[O-])c3cccnc23)nc1 |
| InChI | InChI=1S/C18H17N5O3/c1-12-4-7-16(21-11-12)22-17(24)8-10-19-14-5-6-15(23(25)26)13-3-2-9-20-18(13)14/h2-7,9,11,19H,8,10H2,1H3,(H,21,22,24) |
| InChIKey | QCNZAEBTKUCATO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|