C16H17N5O4 — CID 133301141
2-[[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]amino]-5-nitrobenzamide (PubChem CID 133301141) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]amino]-5-nitrobenzamide.
| Compound Name | 2-[[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 133301141 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-[[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]amino]-5-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)CCNc2ccc([N+](=O)[O-])cc2C(N)=O)nc1 |
| InChI | InChI=1S/C16H17N5O4/c1-10-2-5-14(19-9-10)20-15(22)6-7-18-13-4-3-11(21(24)25)8-12(13)16(17)23/h2-5,8-9,18H,6-7H2,1H3,(H2,17,23)(H,19,20,22) |
| InChIKey | OOPZYQBJNSACEG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|